C25H36N2O4 — CID 137390063
[4-[3-(2-adamantylperoxy)cyclohexyl]phenyl] N-(2-aminoethyl)carbamate (PubChem CID 137390063) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is [4-[3-(2-adamantylperoxy)cyclohexyl]phenyl] N-(2-aminoethyl)carbamate.
| Compound Name | [4-[3-(2-adamantylperoxy)cyclohexyl]phenyl] N-(2-aminoethyl)carbamate |
|---|---|
| PubChem CID | 137390063 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | [4-[3-(2-adamantylperoxy)cyclohexyl]phenyl] N-(2-aminoethyl)carbamate |
| SMILES | NCCNC(=O)Oc1ccc(C2CCCC(OOC3C4CC5CC(C4)CC3C5)C2)cc1 |
| InChI | InChI=1S/C25H36N2O4/c26-8-9-27-25(28)29-22-6-4-18(5-7-22)19-2-1-3-23(15-19)30-31-24-20-11-16-10-17(13-20)14-21(24)12-16/h4-7,16-17,19-21,23-24H,1-3,8-15,26H2,(H,27,28) |
| InChIKey | NBMXBJBLXUATPZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|