C27H40N2O4 — CID 137390035
[4-[(3R)-3-[(7-methyl-3-bicyclo[3.3.1]nonanyl)peroxy]cyclohexyl]phenyl] piperazine-1-carboxylate (PubChem CID 137390035) has the molecular formula C27H40N2O4 and a molecular weight of 456.63 g/mol. Its IUPAC name is [4-[(3R)-3-[(7-methyl-3-bicyclo[3.3.1]nonanyl)peroxy]cyclohexyl]phenyl] piperazine-1-carboxylate.
| Compound Name | [4-[(3R)-3-[(7-methyl-3-bicyclo[3.3.1]nonanyl)peroxy]cyclohexyl]phenyl] piperazine-1-carboxylate |
|---|---|
| PubChem CID | 137390035 |
| Molecular Formula | C27H40N2O4 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | [4-[(3R)-3-[(7-methyl-3-bicyclo[3.3.1]nonanyl)peroxy]cyclohexyl]phenyl] piperazine-1-carboxylate |
| SMILES | CC1CC2CC(C1)CC(OO[C@@H]1CCCC(c3ccc(OC(=O)N4CCNCC4)cc3)C1)C2 |
| InChI | InChI=1S/C27H40N2O4/c1-19-13-20-15-21(14-19)17-26(16-20)33-32-25-4-2-3-23(18-25)22-5-7-24(8-6-22)31-27(30)29-11-9-28-10-12-29/h5-8,19-21,23,25-26,28H,2-4,9-18H2,1H3/t19?,20?,21?,23?,25-,26?/m1/s1 |
| InChIKey | VXHQRNCGRWQOOQ-ZRVNVBDZSA-N |
| XLogP | 5.28 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|