C29H44N2O5 — CID 146582123
[4-(12-methyl-4,5,13-trioxatricyclo[12.3.1.13,16]nonadecan-8-yl)phenyl] 4-aminopiperidine-1-carboxylate (PubChem CID 146582123) has the molecular formula C29H44N2O5 and a molecular weight of 500.68 g/mol. Its IUPAC name is [4-(12-methyl-4,5,13-trioxatricyclo[12.3.1.13,16]nonadecan-8-yl)phenyl] 4-aminopiperidine-1-carboxylate.
| Compound Name | [4-(12-methyl-4,5,13-trioxatricyclo[12.3.1.13,16]nonadecan-8-yl)phenyl] 4-aminopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 146582123 |
| Molecular Formula | C29H44N2O5 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | [4-(12-methyl-4,5,13-trioxatricyclo[12.3.1.13,16]nonadecan-8-yl)phenyl] 4-aminopiperidine-1-carboxylate |
| SMILES | CC1CCCC(c2ccc(OC(=O)N3CCC(N)CC3)cc2)CCOOC2CC3CC(C2)CC(C3)O1 |
| InChI | InChI=1S/C29H44N2O5/c1-20-3-2-4-23(11-14-33-36-28-18-21-15-22(19-28)17-27(16-21)34-20)24-5-7-26(8-6-24)35-29(32)31-12-9-25(30)10-13-31/h5-8,20-23,25,27-28H,2-4,9-19,30H2,1H3 |
| InChIKey | HEIAJWSACUNMTI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|