About CID 167276426
CID 167276426 (PubChem CID 167276426) has the molecular formula C27H35NO6
and a molecular weight of 469.58 g/mol.
Molecular Properties
| Compound Name | CID 167276426 |
| PubChem CID | 167276426 |
| Molecular Formula | C27H35NO6 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | — |
| SMILES | O=C(Oc1ccc(C2CCC[C@]3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)cc1)N1CCOCC1 |
| InChI | InChI=1S/C27H35NO6/c29-25(28-8-10-30-11-9-28)31-24-5-3-20(4-6-24)21-2-1-7-26(17-21)32-27(34-33-26)22-13-18-12-19(15-22)16-23(27)14-18/h3-6,18-19,21-23H,1-2,7-17H2/t18?,19?,21?,22?,23?,26-,27?/m1/s1 |
| InChIKey | HIKWPSUCVIXYPO-MCUMNHQISA-N |
| XLogP | 5.00 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 167276426 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167276426?
The IUPAC name of CID 167276426 (CID 167276426) is not available.
What is the SMILES notation for CID 167276426?
The canonical SMILES for CID 167276426 is O=C(Oc1ccc(C2CCC[C@]3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)cc1)N1CCOCC1.
What is the InChIKey of CID 167276426?
The InChIKey is HIKWPSUCVIXYPO-MCUMNHQISA-N. The full InChI is InChI=1S/C27H35NO6/c29-25(28-8-10-30-11-9-28)31-24-5-3-20(4-6-24)21-2-1-7-26(17-21)32-27(34-33-26)22-13-18-12-19(15-22)16-23(27)14-18/h3-6,18-19,21-23H,1-2,7-17H2/t18?,19?,21?,22?,23?,26-,27?/m1/s1.
What are the key properties of CID 167276426?
CID 167276426 has a molecular weight of 469.58 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167276426 is sourced from PubChem (CID 167276426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).