About CID 24987030
CID 24987030 (PubChem CID 24987030) has the molecular formula C29H39F2NO4
and a molecular weight of 503.63 g/mol.
Molecular Properties
| Compound Name | CID 24987030 |
| PubChem CID | 24987030 |
| Molecular Formula | C29H39F2NO4 |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | — |
| SMILES | FC1(F)CCN(CCOc2ccc(C3CCC4(CC3)OOC3(O4)C4CC5CC(C4)CC3C5)cc2)CC1 |
| InChI | InChI=1S/C29H39F2NO4/c30-27(31)9-11-32(12-10-27)13-14-33-26-3-1-22(2-4-26)23-5-7-28(8-6-23)34-29(36-35-28)24-16-20-15-21(18-24)19-25(29)17-20/h1-4,20-21,23-25H,5-19H2 |
| InChIKey | PCUMPDZAYTWXKZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 24987030 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24987030?
The IUPAC name of CID 24987030 (CID 24987030) is not available.
What is the SMILES notation for CID 24987030?
The canonical SMILES for CID 24987030 is FC1(F)CCN(CCOc2ccc(C3CCC4(CC3)OOC3(O4)C4CC5CC(C4)CC3C5)cc2)CC1.
What is the InChIKey of CID 24987030?
The InChIKey is PCUMPDZAYTWXKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H39F2NO4/c30-27(31)9-11-32(12-10-27)13-14-33-26-3-1-22(2-4-26)23-5-7-28(8-6-23)34-29(36-35-28)24-16-20-15-21(18-24)19-25(29)17-20/h1-4,20-21,23-25H,5-19H2.
What are the key properties of CID 24987030?
CID 24987030 has a molecular weight of 503.63 g/mol, XLogP of 6.28, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24987030 is sourced from PubChem (CID 24987030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).