About CID 24987027
CID 24987027 (PubChem CID 24987027) has the molecular formula C31H44F3NO7S
and a molecular weight of 631.75 g/mol.
Molecular Properties
| Compound Name | CID 24987027 |
| PubChem CID | 24987027 |
| Molecular Formula | C31H44F3NO7S |
| Molecular Weight | 631.75 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)O.FC(F)(F)C1CCN(CCOc2ccc(C3CCC4(CC3)OOC3(O4)C4CC5CC(C4)CC3C5)cc2)CC1 |
| InChI | InChI=1S/C30H40F3NO4.CH4O3S/c31-30(32,33)24-7-11-34(12-8-24)13-14-35-27-3-1-22(2-4-27)23-5-9-28(10-6-23)36-29(38-37-28)25-16-20-15-21(18-25)19-26(29)17-20;1-5(2,3)4/h1-4,20-21,23-26H,5-19H2;1H3,(H,2,3,4) |
| InChIKey | ANQHXMKPINXJKQ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 631.75 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 24987027 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24987027?
The IUPAC name of CID 24987027 (CID 24987027) is not available.
What is the SMILES notation for CID 24987027?
The canonical SMILES for CID 24987027 is CS(=O)(=O)O.FC(F)(F)C1CCN(CCOc2ccc(C3CCC4(CC3)OOC3(O4)C4CC5CC(C4)CC3C5)cc2)CC1.
What is the InChIKey of CID 24987027?
The InChIKey is ANQHXMKPINXJKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H40F3NO4.CH4O3S/c31-30(32,33)24-7-11-34(12-8-24)13-14-35-27-3-1-22(2-4-27)23-5-9-28(10-6-23)36-29(38-37-28)25-16-20-15-21(18-25)19-26(29)17-20;1-5(2,3)4/h1-4,20-21,23-26H,5-19H2;1H3,(H,2,3,4).
What are the key properties of CID 24987027?
CID 24987027 has a molecular weight of 631.75 g/mol, XLogP of 6.33, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24987027 is sourced from PubChem (CID 24987027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).