C30H45NO4 — CID 89274457
1-[2-[4-[(3S)-3-(3-bicyclo[3.3.1]nonanyl)-3-methyl-1,2,4-trioxaspiro[4.5]decan-8-yl]phenoxy]ethyl]piperidine (PubChem CID 89274457) has the molecular formula C30H45NO4 and a molecular weight of 483.69 g/mol. Its IUPAC name is 1-[2-[4-[(3S)-3-(3-bicyclo[3.3.1]nonanyl)-3-methyl-1,2,4-trioxaspiro[4.5]decan-8-yl]phenoxy]ethyl]piperidine.
| Compound Name | 1-[2-[4-[(3S)-3-(3-bicyclo[3.3.1]nonanyl)-3-methyl-1,2,4-trioxaspiro[4.5]decan-8-yl]phenoxy]ethyl]piperidine |
|---|---|
| PubChem CID | 89274457 |
| Molecular Formula | C30H45NO4 |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.33 |
| IUPAC Name | 1-[2-[4-[(3S)-3-(3-bicyclo[3.3.1]nonanyl)-3-methyl-1,2,4-trioxaspiro[4.5]decan-8-yl]phenoxy]ethyl]piperidine |
| SMILES | C[C@@]1(C2CC3CCCC(C3)C2)OOC2(CCC(c3ccc(OCCN4CCCCC4)cc3)CC2)O1 |
| InChI | InChI=1S/C30H45NO4/c1-29(27-21-23-6-5-7-24(20-23)22-27)33-30(35-34-29)14-12-26(13-15-30)25-8-10-28(11-9-25)32-19-18-31-16-3-2-4-17-31/h8-11,23-24,26-27H,2-7,12-22H2,1H3/t23?,24?,26?,27?,29-,30?/m0/s1 |
| InChIKey | IQTRGGVCEJUEFX-VBKATVRYSA-N |
| XLogP | 6.82 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|