About CID 137390088
CID 137390088 (PubChem CID 137390088) has the molecular formula C27H38N2O5
and a molecular weight of 470.61 g/mol.
Molecular Properties
| Compound Name | CID 137390088 |
| PubChem CID | 137390088 |
| Molecular Formula | C27H38N2O5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | — |
| SMILES | c1cc(OCCN2CCOCC2)ncc1C1CCC[C@]2(C1)OOC1(O2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C27H38N2O5/c1-2-21(22-3-4-25(28-18-22)31-11-8-29-6-9-30-10-7-29)17-26(5-1)32-27(34-33-26)23-13-19-12-20(15-23)16-24(27)14-19/h3-4,18-21,23-24H,1-2,5-17H2/t19?,20?,21?,23?,24?,26-,27?/m1/s1 |
| InChIKey | LTQAFSFFYYJDNL-DMKZBPNFSA-N |
| XLogP | 4.28 |
| TPSA | 62.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 137390088 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 137390088?
The IUPAC name of CID 137390088 (CID 137390088) is not available.
What is the SMILES notation for CID 137390088?
The canonical SMILES for CID 137390088 is c1cc(OCCN2CCOCC2)ncc1C1CCC[C@]2(C1)OOC1(O2)C2CC3CC(C2)CC1C3.
What is the InChIKey of CID 137390088?
The InChIKey is LTQAFSFFYYJDNL-DMKZBPNFSA-N. The full InChI is InChI=1S/C27H38N2O5/c1-2-21(22-3-4-25(28-18-22)31-11-8-29-6-9-30-10-7-29)17-26(5-1)32-27(34-33-26)23-13-19-12-20(15-23)16-24(27)14-19/h3-4,18-21,23-24H,1-2,5-17H2/t19?,20?,21?,23?,24?,26-,27?/m1/s1.
What are the key properties of CID 137390088?
CID 137390088 has a molecular weight of 470.61 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 137390088 is sourced from PubChem (CID 137390088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).