About CID 159188495
CID 159188495 (PubChem CID 159188495) has the molecular formula C31H46O4
and a molecular weight of 482.71 g/mol.
Molecular Properties
| Compound Name | CID 159188495 |
| PubChem CID | 159188495 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | — |
| SMILES | CC(C)(C)CCCCCOc1ccc(C2CCC[C@]3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C31H46O4/c1-29(2,3)13-5-4-6-15-32-28-11-9-24(10-12-28)25-8-7-14-30(21-25)33-31(35-34-30)26-17-22-16-23(19-26)20-27(31)18-22/h9-12,22-23,25-27H,4-8,13-21H2,1-3H3/t22?,23?,25?,26?,27?,30-,31?/m1/s1 |
| InChIKey | HCAJXLOXUZRXIN-ULTHPURXSA-N |
| XLogP | 8.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 159188495 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159188495?
The IUPAC name of CID 159188495 (CID 159188495) is not available.
What is the SMILES notation for CID 159188495?
The canonical SMILES for CID 159188495 is CC(C)(C)CCCCCOc1ccc(C2CCC[C@]3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)cc1.
What is the InChIKey of CID 159188495?
The InChIKey is HCAJXLOXUZRXIN-ULTHPURXSA-N. The full InChI is InChI=1S/C31H46O4/c1-29(2,3)13-5-4-6-15-32-28-11-9-24(10-12-28)25-8-7-14-30(21-25)33-31(35-34-30)26-17-22-16-23(19-26)20-27(31)18-22/h9-12,22-23,25-27H,4-8,13-21H2,1-3H3/t22?,23?,25?,26?,27?,30-,31?/m1/s1.
What are the key properties of CID 159188495?
CID 159188495 has a molecular weight of 482.71 g/mol, XLogP of 8.16, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159188495 is sourced from PubChem (CID 159188495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).