C35H41FN2O6 — CID 137390075
CID 137390075 (PubChem CID 137390075) has the molecular formula C35H41FN2O6 and a molecular weight of 604.72 g/mol.
| Compound Name | CID 137390075 |
|---|---|
| PubChem CID | 137390075 |
| Molecular Formula | C35H41FN2O6 |
| Molecular Weight | 604.72 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | — |
| SMILES | O=C(NC1CCN(C(=O)Oc2ccc([C@@H]3CCC[C@]4(C3)OOC3(O4)C4CC5CC(C4)CC3C5)cc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C35H41FN2O6/c36-29-7-3-25(4-8-29)32(39)37-30-11-14-38(15-12-30)33(40)41-31-9-5-24(6-10-31)26-2-1-13-34(21-26)42-35(44-43-34)27-17-22-16-23(19-27)20-28(35)18-22/h3-10,22-23,26-28,30H,1-2,11-21H2,(H,37,39)/t22?,23?,26-,27?,28?,34-,35?/m1/s1 |
| InChIKey | UHUIPHYJGYPINQ-LPTNTAFJSA-N |
| XLogP | 6.70 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.72 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|