C37H49FN4O7 — CID 146582145
[4-[(3R,5R,7R)-3-[5-[4-[(4-fluorobenzoyl)amino]butanoylamino]hex-5-en-3-yl]-3-methyl-1,2,4-trioxaspiro[4.5]decan-7-yl]phenyl] 4-aminopiperidine-1-carboxylate (PubChem CID 146582145) has the molecular formula C37H49FN4O7 and a molecular weight of 680.82 g/mol. Its IUPAC name is [4-[(3R,5R,7R)-3-[5-[4-[(4-fluorobenzoyl)amino]butanoylamino]hex-5-en-3-yl]-3-methyl-1,2,4-trioxaspiro[4.5]decan-7-yl]phenyl] 4-aminopiperidine-1-carboxylate.
| Compound Name | [4-[(3R,5R,7R)-3-[5-[4-[(4-fluorobenzoyl)amino]butanoylamino]hex-5-en-3-yl]-3-methyl-1,2,4-trioxaspiro[4.5]decan-7-yl]phenyl] 4-aminopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 146582145 |
| Molecular Formula | C37H49FN4O7 |
| Molecular Weight | 680.82 g/mol |
| Exact Mass | 680.36 |
| IUPAC Name | [4-[(3R,5R,7R)-3-[5-[4-[(4-fluorobenzoyl)amino]butanoylamino]hex-5-en-3-yl]-3-methyl-1,2,4-trioxaspiro[4.5]decan-7-yl]phenyl] 4-aminopiperidine-1-carboxylate |
| SMILES | C=C(CC(CC)[C@@]1(C)OO[C@@]2(CCC[C@@H](c3ccc(OC(=O)N4CCC(N)CC4)cc3)C2)O1)NC(=O)CCCNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C37H49FN4O7/c1-4-29(23-25(2)41-33(43)8-6-20-40-34(44)27-9-13-30(38)14-10-27)36(3)47-37(49-48-36)19-5-7-28(24-37)26-11-15-32(16-12-26)46-35(45)42-21-17-31(39)18-22-42/h9-16,28-29,31H,2,4-8,17-24,39H2,1,3H3,(H,40,44)(H,41,43)/t28-,29?,36-,37-/m1/s1 |
| InChIKey | JATOEZAHMRZFSO-YERZORMZSA-N |
| XLogP | 6.05 |
| TPSA | 141.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.82 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|