C12H17NO4 — CID 137390518
2-(1,3-dihydroxypropan-2-yloxy)-3-ethylbenzamide (PubChem CID 137390518) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-(1,3-dihydroxypropan-2-yloxy)-3-ethylbenzamide.
| Compound Name | 2-(1,3-dihydroxypropan-2-yloxy)-3-ethylbenzamide |
|---|---|
| PubChem CID | 137390518 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2-(1,3-dihydroxypropan-2-yloxy)-3-ethylbenzamide |
| SMILES | CCc1cccc(C(N)=O)c1OC(CO)CO |
| InChI | InChI=1S/C12H17NO4/c1-2-8-4-3-5-10(12(13)16)11(8)17-9(6-14)7-15/h3-5,9,14-15H,2,6-7H2,1H3,(H2,13,16) |
| InChIKey | FOHPPLULGUYUHP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |