C28H15N5O2 — CID 137390612
2-[(E)-3-[5-[5-[5-(2,2-dicyanoethenyl)furan-2-yl]-1-phenylpyrrol-2-yl]furan-2-yl]prop-2-enylidene]propanedinitrile (PubChem CID 137390612) has the molecular formula C28H15N5O2 and a molecular weight of 453.46 g/mol. Its IUPAC name is 2-[(E)-3-[5-[5-[5-(2,2-dicyanoethenyl)furan-2-yl]-1-phenylpyrrol-2-yl]furan-2-yl]prop-2-enylidene]propanedinitrile.
| Compound Name | 2-[(E)-3-[5-[5-[5-(2,2-dicyanoethenyl)furan-2-yl]-1-phenylpyrrol-2-yl]furan-2-yl]prop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 137390612 |
| Molecular Formula | C28H15N5O2 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2-[(E)-3-[5-[5-[5-(2,2-dicyanoethenyl)furan-2-yl]-1-phenylpyrrol-2-yl]furan-2-yl]prop-2-enylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C/C=C/c1ccc(-c2ccc(-c3ccc(C=C(C#N)C#N)o3)n2-c2ccccc2)o1 |
| InChI | InChI=1S/C28H15N5O2/c29-16-20(17-30)5-4-8-23-9-13-27(34-23)25-11-12-26(33(25)22-6-2-1-3-7-22)28-14-10-24(35-28)15-21(18-31)19-32/h1-15H/b8-4+ |
| InChIKey | WITFUSNIURIYIM-XBXARRHUSA-N |
| XLogP | 6.41 |
| TPSA | 126.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|