C31H19N5O2S — CID 164563387
2-[(E)-3-[5-[6-[5-(2,2-dicyanoethenyl)furan-2-yl]-4-propylthieno[3,2-b]indol-2-yl]furan-2-yl]prop-2-enylidene]propanedinitrile (PubChem CID 164563387) has the molecular formula C31H19N5O2S and a molecular weight of 525.59 g/mol. Its IUPAC name is 2-[(E)-3-[5-[6-[5-(2,2-dicyanoethenyl)furan-2-yl]-4-propylthieno[3,2-b]indol-2-yl]furan-2-yl]prop-2-enylidene]propanedinitrile.
| Compound Name | 2-[(E)-3-[5-[6-[5-(2,2-dicyanoethenyl)furan-2-yl]-4-propylthieno[3,2-b]indol-2-yl]furan-2-yl]prop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 164563387 |
| Molecular Formula | C31H19N5O2S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 2-[(E)-3-[5-[6-[5-(2,2-dicyanoethenyl)furan-2-yl]-4-propylthieno[3,2-b]indol-2-yl]furan-2-yl]prop-2-enylidene]propanedinitrile |
| SMILES | CCCn1c2cc(-c3ccc(C=C(C#N)C#N)o3)ccc2c2sc(-c3ccc(/C=C/C=C(C#N)C#N)o3)cc21 |
| InChI | InChI=1S/C31H19N5O2S/c1-2-12-36-26-14-22(28-10-8-24(38-28)13-21(18-34)19-35)6-9-25(26)31-27(36)15-30(39-31)29-11-7-23(37-29)5-3-4-20(16-32)17-33/h3-11,13-15H,2,12H2,1H3/b5-3+ |
| InChIKey | NUNAZYHJAPQPEK-HWKANZROSA-N |
| XLogP | 8.20 |
| TPSA | 126.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|