C31H28N2O2S — CID 167153897
(2Z,4E)-2-methyl-5-[5-[6-[5-(2-methylprop-1-enyl)furan-2-yl]-4-propylthieno[3,2-b]indol-2-yl]furan-2-yl]penta-2,4-dienenitrile (PubChem CID 167153897) has the molecular formula C31H28N2O2S and a molecular weight of 492.64 g/mol. Its IUPAC name is (2Z,4E)-2-methyl-5-[5-[6-[5-(2-methylprop-1-enyl)furan-2-yl]-4-propylthieno[3,2-b]indol-2-yl]furan-2-yl]penta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-2-methyl-5-[5-[6-[5-(2-methylprop-1-enyl)furan-2-yl]-4-propylthieno[3,2-b]indol-2-yl]furan-2-yl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 167153897 |
| Molecular Formula | C31H28N2O2S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | (2Z,4E)-2-methyl-5-[5-[6-[5-(2-methylprop-1-enyl)furan-2-yl]-4-propylthieno[3,2-b]indol-2-yl]furan-2-yl]penta-2,4-dienenitrile |
| SMILES | CCCn1c2cc(-c3ccc(C=C(C)C)o3)ccc2c2sc(-c3ccc(/C=C/C=C(/C)C#N)o3)cc21 |
| InChI | InChI=1S/C31H28N2O2S/c1-5-15-33-26-17-22(28-13-11-24(35-28)16-20(2)3)9-12-25(26)31-27(33)18-30(36-31)29-14-10-23(34-29)8-6-7-21(4)19-32/h6-14,16-18H,5,15H2,1-4H3/b8-6+,21-7- |
| InChIKey | PJYVYOCUKGRIOA-GOZKHROGSA-N |
| XLogP | 9.69 |
| TPSA | 55.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|