C28H19N5O2 — CID 167153889
2-[(E)-3-[4-butan-2-yl-6-[5-(2,2-dicyanoethenyl)furan-2-yl]furo[3,2-b]indol-2-yl]prop-2-enylidene]propanedinitrile (PubChem CID 167153889) has the molecular formula C28H19N5O2 and a molecular weight of 457.49 g/mol. Its IUPAC name is 2-[(E)-3-[4-butan-2-yl-6-[5-(2,2-dicyanoethenyl)furan-2-yl]furo[3,2-b]indol-2-yl]prop-2-enylidene]propanedinitrile.
| Compound Name | 2-[(E)-3-[4-butan-2-yl-6-[5-(2,2-dicyanoethenyl)furan-2-yl]furo[3,2-b]indol-2-yl]prop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 167153889 |
| Molecular Formula | C28H19N5O2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2-[(E)-3-[4-butan-2-yl-6-[5-(2,2-dicyanoethenyl)furan-2-yl]furo[3,2-b]indol-2-yl]prop-2-enylidene]propanedinitrile |
| SMILES | CCC(C)n1c2cc(-c3ccc(C=C(C#N)C#N)o3)ccc2c2oc(/C=C/C=C(C#N)C#N)cc21 |
| InChI | InChI=1S/C28H19N5O2/c1-3-18(2)33-25-12-21(27-10-8-23(34-27)11-20(16-31)17-32)7-9-24(25)28-26(33)13-22(35-28)6-4-5-19(14-29)15-30/h4-13,18H,3H2,1-2H3/b6-4+ |
| InChIKey | MUAQOENECHIDEV-GQCTYLIASA-N |
| XLogP | 7.04 |
| TPSA | 126.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|