C18H22N4O2S — CID 137390669
N'-[(2R)-2-amino-4-phenylbutanoyl]-4-[(sulfanylamino)methyl]benzohydrazide (PubChem CID 137390669) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N'-[(2R)-2-amino-4-phenylbutanoyl]-4-[(sulfanylamino)methyl]benzohydrazide.
| Compound Name | N'-[(2R)-2-amino-4-phenylbutanoyl]-4-[(sulfanylamino)methyl]benzohydrazide |
|---|---|
| PubChem CID | 137390669 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N'-[(2R)-2-amino-4-phenylbutanoyl]-4-[(sulfanylamino)methyl]benzohydrazide |
| SMILES | N[C@H](CCc1ccccc1)C(=O)NNC(=O)c1ccc(CNS)cc1 |
| InChI | InChI=1S/C18H22N4O2S/c19-16(11-8-13-4-2-1-3-5-13)18(24)22-21-17(23)15-9-6-14(7-10-15)12-20-25/h1-7,9-10,16,20,25H,8,11-12,19H2,(H,21,23)(H,22,24)/t16-/m1/s1 |
| InChIKey | UYIIJDKWCFIYLP-MRXNPFEDSA-N |
| XLogP | 1.34 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|