C22H15FN4O — CID 137393651
7-[8-amino-6-(3-fluorophenyl)imidazo[1,2-a]pyrazin-5-yl]naphthalen-1-ol (PubChem CID 137393651) has the molecular formula C22H15FN4O and a molecular weight of 370.39 g/mol. Its IUPAC name is 7-[8-amino-6-(3-fluorophenyl)imidazo[1,2-a]pyrazin-5-yl]naphthalen-1-ol.
| Compound Name | 7-[8-amino-6-(3-fluorophenyl)imidazo[1,2-a]pyrazin-5-yl]naphthalen-1-ol |
|---|---|
| PubChem CID | 137393651 |
| Molecular Formula | C22H15FN4O |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 7-[8-amino-6-(3-fluorophenyl)imidazo[1,2-a]pyrazin-5-yl]naphthalen-1-ol |
| SMILES | Nc1nc(-c2cccc(F)c2)c(-c2ccc3cccc(O)c3c2)n2ccnc12 |
| InChI | InChI=1S/C22H15FN4O/c23-16-5-1-4-14(11-16)19-20(27-10-9-25-22(27)21(24)26-19)15-8-7-13-3-2-6-18(28)17(13)12-15/h1-12,28H,(H2,24,26) |
| InChIKey | SVCUBHROSSOHQH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |