C22H20N6OS — CID 137394174
[4-[4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazol-2-yl]phenyl]-(methylamino)methanol (PubChem CID 137394174) has the molecular formula C22H20N6OS and a molecular weight of 416.51 g/mol. Its IUPAC name is [4-[4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazol-2-yl]phenyl]-(methylamino)methanol.
| Compound Name | [4-[4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazol-2-yl]phenyl]-(methylamino)methanol |
|---|---|
| PubChem CID | 137394174 |
| Molecular Formula | C22H20N6OS |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [4-[4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazol-2-yl]phenyl]-(methylamino)methanol |
| SMILES | CNC(O)c1ccc(-c2nc(-c3ccc4ncsc4c3)c(-c3ccn(C)n3)[nH]2)cc1 |
| InChI | InChI=1S/C22H20N6OS/c1-23-22(29)14-5-3-13(4-6-14)21-25-19(20(26-21)17-9-10-28(2)27-17)15-7-8-16-18(11-15)30-12-24-16/h3-12,22-23,29H,1-2H3,(H,25,26) |
| InChIKey | QDWPRHVTCAOHLH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|