C22H27FN4O5S2 — CID 137394646
2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-N-[2-(2-methoxyethylamino)ethyl]-2-(2-methoxyethylsulfonyl)acetamide (PubChem CID 137394646) has the molecular formula C22H27FN4O5S2 and a molecular weight of 510.61 g/mol. Its IUPAC name is 2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-N-[2-(2-methoxyethylamino)ethyl]-2-(2-methoxyethylsulfonyl)acetamide.
| Compound Name | 2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-N-[2-(2-methoxyethylamino)ethyl]-2-(2-methoxyethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 137394646 |
| Molecular Formula | C22H27FN4O5S2 |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-N-[2-(2-methoxyethylamino)ethyl]-2-(2-methoxyethylsulfonyl)acetamide |
| SMILES | COCCNCCNC(=O)C(c1nc2ccc(-c3ccc(F)nc3)cc2s1)S(=O)(=O)CCOC |
| InChI | InChI=1S/C22H27FN4O5S2/c1-31-10-9-24-7-8-25-21(28)20(34(29,30)12-11-32-2)22-27-17-5-3-15(13-18(17)33-22)16-4-6-19(23)26-14-16/h3-6,13-14,20,24H,7-12H2,1-2H3,(H,25,28) |
| InChIKey | DPYBAIRBIUSGND-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|