C20H23FN4O5S2 — CID 72949893
N-[2-(ethylamino)-1-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-oxoethyl]butanamide;sulfurous acid (PubChem CID 72949893) has the molecular formula C20H23FN4O5S2 and a molecular weight of 482.56 g/mol. Its IUPAC name is N-[2-(ethylamino)-1-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-oxoethyl]butanamide;sulfurous acid.
| Compound Name | N-[2-(ethylamino)-1-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-oxoethyl]butanamide;sulfurous acid |
|---|---|
| PubChem CID | 72949893 |
| Molecular Formula | C20H23FN4O5S2 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | N-[2-(ethylamino)-1-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-oxoethyl]butanamide;sulfurous acid |
| SMILES | CCCC(=O)NC(C(=O)NCC)c1nc2ccc(-c3ccc(F)nc3)cc2s1.O=S(O)O |
| InChI | InChI=1S/C20H21FN4O2S.H2O3S/c1-3-5-17(26)25-18(19(27)22-4-2)20-24-14-8-6-12(10-15(14)28-20)13-7-9-16(21)23-11-13;1-4(2)3/h6-11,18H,3-5H2,1-2H3,(H,22,27)(H,25,26);(H2,1,2,3) |
| InChIKey | OYBGZGGYYKNXDX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 141.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|