C17H13FN5O4S2- — CID 90047704
2-[1-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-1-hydroxyethyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole (PubChem CID 90047704) has the molecular formula C17H13FN5O4S2- and a molecular weight of 434.45 g/mol. Its IUPAC name is 2-[1-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-1-hydroxyethyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[1-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-1-hydroxyethyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 90047704 |
| Molecular Formula | C17H13FN5O4S2- |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 2-[1-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-1-hydroxyethyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole |
| SMILES | CC(O)(c1nnc(CNS(=O)[O-])o1)c1nc2ccc(-c3ccc(F)nc3)cc2s1 |
| InChI | InChI=1S/C17H14FN5O4S2/c1-17(24,15-23-22-14(27-15)8-20-29(25)26)16-21-11-4-2-9(6-12(11)28-16)10-3-5-13(18)19-7-10/h2-7,20,24H,8H2,1H3,(H,25,26)/p-1 |
| InChIKey | QDMHTGGFPZPIFF-UHFFFAOYSA-M |
| XLogP | 2.02 |
| TPSA | 137.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|