C16H13FN6O3S2 — CID 144589072
2-[[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]methyl]-5-[(sulfamoylamino)methyl]-1,3,4-oxadiazole (PubChem CID 144589072) has the molecular formula C16H13FN6O3S2 and a molecular weight of 420.45 g/mol. Its IUPAC name is 2-[[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]methyl]-5-[(sulfamoylamino)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]methyl]-5-[(sulfamoylamino)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 144589072 |
| Molecular Formula | C16H13FN6O3S2 |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 2-[[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]methyl]-5-[(sulfamoylamino)methyl]-1,3,4-oxadiazole |
| SMILES | NS(=O)(=O)NCc1nnc(Cc2nc3ccc(-c4ccc(F)nc4)cc3s2)o1 |
| InChI | InChI=1S/C16H13FN6O3S2/c17-13-4-2-10(7-19-13)9-1-3-11-12(5-9)27-16(21-11)6-14-22-23-15(26-14)8-20-28(18,24)25/h1-5,7,20H,6,8H2,(H2,18,24,25) |
| InChIKey | LCNQGADCCOLMCX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 136.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|