C18H25N3O8S — CID 137395465
bis((E)-but-2-enedioic acid);6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (PubChem CID 137395465) has the molecular formula C18H25N3O8S and a molecular weight of 443.48 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine.
| Compound Name | bis((E)-but-2-enedioic acid);6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 137395465 |
| Molecular Formula | C18H25N3O8S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | bis((E)-but-2-enedioic acid);6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| SMILES | CCCNC1CCc2nc(N)sc2C1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C10H17N3S.2C4H4O4/c1-2-5-12-7-3-4-8-9(6-7)14-10(11)13-8;2*5-3(6)1-2-4(7)8/h7,12H,2-6H2,1H3,(H2,11,13);2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | DWNFMQJUBMUPNU-LVEZLNDCSA-N |
| XLogP | 1.01 |
| TPSA | 200.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|