C11H16N2OS — CID 140994202
6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-2-carbaldehyde (PubChem CID 140994202) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-2-carbaldehyde.
| Compound Name | 6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 140994202 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-2-carbaldehyde |
| SMILES | CCCNC1CCc2nc(C=O)sc2C1 |
| InChI | InChI=1S/C11H16N2OS/c1-2-5-12-8-3-4-9-10(6-8)15-11(7-14)13-9/h7-8,12H,2-6H2,1H3 |
| InChIKey | FGPLHVMQLSBGSR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|