C19H33N3OS2 — CID 144548103
2,4,4-trimethyl-N-[6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-5-sulfanylhexanamide (PubChem CID 144548103) has the molecular formula C19H33N3OS2 and a molecular weight of 383.63 g/mol. Its IUPAC name is 2,4,4-trimethyl-N-[6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-5-sulfanylhexanamide.
| Compound Name | 2,4,4-trimethyl-N-[6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-5-sulfanylhexanamide |
|---|---|
| PubChem CID | 144548103 |
| Molecular Formula | C19H33N3OS2 |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 2,4,4-trimethyl-N-[6-(propylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-5-sulfanylhexanamide |
| SMILES | CCCNC1CCc2nc(NC(=O)C(C)CC(C)(C)C(C)S)sc2C1 |
| InChI | InChI=1S/C19H33N3OS2/c1-6-9-20-14-7-8-15-16(10-14)25-18(21-15)22-17(23)12(2)11-19(4,5)13(3)24/h12-14,20,24H,6-11H2,1-5H3,(H,21,22,23) |
| InChIKey | XRGMVEHIHUAIET-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|