C13H21BrO — CID 137398894
(4Z,7Z)-1-bromotrideca-4,7-dien-2-one (PubChem CID 137398894) has the molecular formula C13H21BrO and a molecular weight of 273.21 g/mol. Its IUPAC name is (4Z,7Z)-1-bromotrideca-4,7-dien-2-one.
| Compound Name | (4Z,7Z)-1-bromotrideca-4,7-dien-2-one |
|---|---|
| PubChem CID | 137398894 |
| Molecular Formula | C13H21BrO |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (4Z,7Z)-1-bromotrideca-4,7-dien-2-one |
| SMILES | CCCCC/C=C\C/C=C\CC(=O)CBr |
| InChI | InChI=1S/C13H21BrO/c1-2-3-4-5-6-7-8-9-10-11-13(15)12-14/h6-7,9-10H,2-5,8,11-12H2,1H3/b7-6-,10-9- |
| InChIKey | GSUVAQVWIDSBDG-HZJYTTRNSA-N |
| XLogP | 4.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|