C17H20ClF3N2O4S — CID 137399599
N-[(1R,3S)-3-[[2-(4-chlorophenoxy)acetyl]amino]-4-sulfanylcyclopentyl]-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 137399599) has the molecular formula C17H20ClF3N2O4S and a molecular weight of 440.87 g/mol. Its IUPAC name is N-[(1R,3S)-3-[[2-(4-chlorophenoxy)acetyl]amino]-4-sulfanylcyclopentyl]-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-[(1R,3S)-3-[[2-(4-chlorophenoxy)acetyl]amino]-4-sulfanylcyclopentyl]-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 137399599 |
| Molecular Formula | C17H20ClF3N2O4S |
| Molecular Weight | 440.87 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | N-[(1R,3S)-3-[[2-(4-chlorophenoxy)acetyl]amino]-4-sulfanylcyclopentyl]-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(COCC(F)(F)F)N[C@H]1CC(S)[C@@H](NC(=O)COc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H20ClF3N2O4S/c18-10-1-3-12(4-2-10)27-8-16(25)23-13-5-11(6-14(13)28)22-15(24)7-26-9-17(19,20)21/h1-4,11,13-14,28H,5-9H2,(H,22,24)(H,23,25)/t11-,13+,14?/m1/s1 |
| InChIKey | XRNVCHSPFRIKFU-LXKBMQFRSA-N |
| XLogP | 2.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.87 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|