C14H20F2N4O3 — CID 137399664
4-(cyclohexylamino)-2-[2-(difluoromethoxy)ethylamino]pyrimidine-5-carboxylic acid (PubChem CID 137399664) has the molecular formula C14H20F2N4O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-(cyclohexylamino)-2-[2-(difluoromethoxy)ethylamino]pyrimidine-5-carboxylic acid.
| Compound Name | 4-(cyclohexylamino)-2-[2-(difluoromethoxy)ethylamino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 137399664 |
| Molecular Formula | C14H20F2N4O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-(cyclohexylamino)-2-[2-(difluoromethoxy)ethylamino]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCCOC(F)F)nc1NC1CCCCC1 |
| InChI | InChI=1S/C14H20F2N4O3/c15-13(16)23-7-6-17-14-18-8-10(12(21)22)11(20-14)19-9-4-2-1-3-5-9/h8-9,13H,1-7H2,(H,21,22)(H2,17,18,19,20) |
| InChIKey | VDTGNDPMRXXYFK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|