C15H24O3 — CID 137402187
4,4,6,6-tetramethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione (PubChem CID 137402187) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 4,4,6,6-tetramethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione.
| Compound Name | 4,4,6,6-tetramethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 137402187 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 4,4,6,6-tetramethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione |
| SMILES | CC(C)CC(=O)C1C(=O)C(C)(C)CC(C)(C)C1=O |
| InChI | InChI=1S/C15H24O3/c1-9(2)7-10(16)11-12(17)14(3,4)8-15(5,6)13(11)18/h9,11H,7-8H2,1-6H3 |
| InChIKey | FXYQZNIBRSVVHU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|