C7H11N3O3S — CID 137403126
2-oxo-1-propan-2-ylpyrimidine-5-sulfonamide (PubChem CID 137403126) has the molecular formula C7H11N3O3S and a molecular weight of 217.25 g/mol. Its IUPAC name is 2-oxo-1-propan-2-ylpyrimidine-5-sulfonamide.
| Compound Name | 2-oxo-1-propan-2-ylpyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 137403126 |
| Molecular Formula | C7H11N3O3S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 2-oxo-1-propan-2-ylpyrimidine-5-sulfonamide |
| SMILES | CC(C)n1cc(S(N)(=O)=O)cnc1=O |
| InChI | InChI=1S/C7H11N3O3S/c1-5(2)10-4-6(14(8,12)13)3-9-7(10)11/h3-5H,1-2H3,(H2,8,12,13) |
| InChIKey | LLWGPPQRSGKHRL-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |