C11H23N3O2S — CID 137403169
1-(1-ethylpiperidin-4-yl)pyrrolidine-3-sulfonamide (PubChem CID 137403169) has the molecular formula C11H23N3O2S and a molecular weight of 261.39 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-4-yl)pyrrolidine-3-sulfonamide.
| Compound Name | 1-(1-ethylpiperidin-4-yl)pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 137403169 |
| Molecular Formula | C11H23N3O2S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-(1-ethylpiperidin-4-yl)pyrrolidine-3-sulfonamide |
| SMILES | CCN1CCC(N2CCC(S(N)(=O)=O)C2)CC1 |
| InChI | InChI=1S/C11H23N3O2S/c1-2-13-6-3-10(4-7-13)14-8-5-11(9-14)17(12,15)16/h10-11H,2-9H2,1H3,(H2,12,15,16) |
| InChIKey | UYVBIIMRWHYZIG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |