C13H22N2 — CID 171083952
1-(1-ethylpiperidin-4-yl)-2,7-dihydroazepine (PubChem CID 171083952) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-4-yl)-2,7-dihydroazepine.
| Compound Name | 1-(1-ethylpiperidin-4-yl)-2,7-dihydroazepine |
|---|---|
| PubChem CID | 171083952 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-(1-ethylpiperidin-4-yl)-2,7-dihydroazepine |
| SMILES | CCN1CCC(N2CC=CC=CC2)CC1 |
| InChI | InChI=1S/C13H22N2/c1-2-14-11-7-13(8-12-14)15-9-5-3-4-6-10-15/h3-6,13H,2,7-12H2,1H3 |
| InChIKey | IQQWFAUFNGMMTN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |