C17H35N5 — CID 166946089
3-[[4-(1-ethylpiperidin-4-yl)-2,6-dimethylpiperazin-1-yl]methyl]azetidin-1-amine (PubChem CID 166946089) has the molecular formula C17H35N5 and a molecular weight of 309.50 g/mol. Its IUPAC name is 3-[[4-(1-ethylpiperidin-4-yl)-2,6-dimethylpiperazin-1-yl]methyl]azetidin-1-amine.
| Compound Name | 3-[[4-(1-ethylpiperidin-4-yl)-2,6-dimethylpiperazin-1-yl]methyl]azetidin-1-amine |
|---|---|
| PubChem CID | 166946089 |
| Molecular Formula | C17H35N5 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.29 |
| IUPAC Name | 3-[[4-(1-ethylpiperidin-4-yl)-2,6-dimethylpiperazin-1-yl]methyl]azetidin-1-amine |
| SMILES | CCN1CCC(N2CC(C)N(CC3CN(N)C3)C(C)C2)CC1 |
| InChI | InChI=1S/C17H35N5/c1-4-19-7-5-17(6-8-19)20-9-14(2)22(15(3)10-20)13-16-11-21(18)12-16/h14-17H,4-13,18H2,1-3H3 |
| InChIKey | MGZTWZRUQZLQER-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 38.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|