C10H19NO2 — CID 137403708
(2Z,4E)-5-methoxy-2-(methoxymethyl)-N-methylhexa-2,4-dien-1-amine (PubChem CID 137403708) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (2Z,4E)-5-methoxy-2-(methoxymethyl)-N-methylhexa-2,4-dien-1-amine.
| Compound Name | (2Z,4E)-5-methoxy-2-(methoxymethyl)-N-methylhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 137403708 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (2Z,4E)-5-methoxy-2-(methoxymethyl)-N-methylhexa-2,4-dien-1-amine |
| SMILES | CNC/C(=C/C=C(\C)OC)COC |
| InChI | InChI=1S/C10H19NO2/c1-9(13-4)5-6-10(7-11-2)8-12-3/h5-6,11H,7-8H2,1-4H3/b9-5+,10-6- |
| InChIKey | YUXVYZWRXJRBLK-POQLCMLLSA-N |
| XLogP | 1.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|