C22H25FN4O4S — CID 137406884
2-[3-[(4aS,7S,8aR)-3-amino-1,1-dihydroxy-2,2,7-trimethyl-5,7,8,8a-tetrahydropyrano[4,3-b][1,4]thiazin-4a-yl]-4-fluorophenoxy]pyridine-4-carbonitrile (PubChem CID 137406884) has the molecular formula C22H25FN4O4S and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-[3-[(4aS,7S,8aR)-3-amino-1,1-dihydroxy-2,2,7-trimethyl-5,7,8,8a-tetrahydropyrano[4,3-b][1,4]thiazin-4a-yl]-4-fluorophenoxy]pyridine-4-carbonitrile.
| Compound Name | 2-[3-[(4aS,7S,8aR)-3-amino-1,1-dihydroxy-2,2,7-trimethyl-5,7,8,8a-tetrahydropyrano[4,3-b][1,4]thiazin-4a-yl]-4-fluorophenoxy]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 137406884 |
| Molecular Formula | C22H25FN4O4S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[3-[(4aS,7S,8aR)-3-amino-1,1-dihydroxy-2,2,7-trimethyl-5,7,8,8a-tetrahydropyrano[4,3-b][1,4]thiazin-4a-yl]-4-fluorophenoxy]pyridine-4-carbonitrile |
| SMILES | C[C@H]1C[C@@H]2[C@](c3cc(Oc4cc(C#N)ccn4)ccc3F)(CO1)N=C(N)C(C)(C)S2(O)O |
| InChI | InChI=1S/C22H25FN4O4S/c1-13-8-18-22(12-30-13,27-20(25)21(2,3)32(18,28)29)16-10-15(4-5-17(16)23)31-19-9-14(11-24)6-7-26-19/h4-7,9-10,13,18,28-29H,8,12H2,1-3H3,(H2,25,27)/t13-,18+,22+/m0/s1 |
| InChIKey | LYOFQDGMUMLONC-PFDOBSCMSA-N |
| XLogP | 4.16 |
| TPSA | 133.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |