C23H27FN4O4S — CID 166651810
2-[3-[(4aS,8aR)-3-amino-1,1-dihydroxy-2,2,7,7-tetramethyl-8,8a-dihydro-5H-pyrano[4,3-b][1,4]thiazin-4a-yl]-4-fluorophenoxy]pyridine-4-carbonitrile (PubChem CID 166651810) has the molecular formula C23H27FN4O4S and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-[3-[(4aS,8aR)-3-amino-1,1-dihydroxy-2,2,7,7-tetramethyl-8,8a-dihydro-5H-pyrano[4,3-b][1,4]thiazin-4a-yl]-4-fluorophenoxy]pyridine-4-carbonitrile.
| Compound Name | 2-[3-[(4aS,8aR)-3-amino-1,1-dihydroxy-2,2,7,7-tetramethyl-8,8a-dihydro-5H-pyrano[4,3-b][1,4]thiazin-4a-yl]-4-fluorophenoxy]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 166651810 |
| Molecular Formula | C23H27FN4O4S |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-[3-[(4aS,8aR)-3-amino-1,1-dihydroxy-2,2,7,7-tetramethyl-8,8a-dihydro-5H-pyrano[4,3-b][1,4]thiazin-4a-yl]-4-fluorophenoxy]pyridine-4-carbonitrile |
| SMILES | CC1(C)C[C@@H]2[C@](c3cc(Oc4cc(C#N)ccn4)ccc3F)(CO1)N=C(N)C(C)(C)S2(O)O |
| InChI | InChI=1S/C23H27FN4O4S/c1-21(2)11-18-23(13-31-21,28-20(26)22(3,4)33(18,29)30)16-10-15(5-6-17(16)24)32-19-9-14(12-25)7-8-27-19/h5-10,18,29-30H,11,13H2,1-4H3,(H2,26,28)/t18-,23-/m1/s1 |
| InChIKey | AGJRFPWKOKHGNY-WZONZLPQSA-N |
| XLogP | 4.55 |
| TPSA | 133.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |