C15H20N4O4 — CID 137415409
N-(1-acetamidoethylidene)-4-[(2-amino-3-hydroxy-2-methylpropanoyl)amino]benzamide (PubChem CID 137415409) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is N-(1-acetamidoethylidene)-4-[(2-amino-3-hydroxy-2-methylpropanoyl)amino]benzamide.
| Compound Name | N-(1-acetamidoethylidene)-4-[(2-amino-3-hydroxy-2-methylpropanoyl)amino]benzamide |
|---|---|
| PubChem CID | 137415409 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-(1-acetamidoethylidene)-4-[(2-amino-3-hydroxy-2-methylpropanoyl)amino]benzamide |
| SMILES | CC(=O)N/C(C)=N/C(=O)c1ccc(NC(=O)C(C)(N)CO)cc1 |
| InChI | InChI=1S/C15H20N4O4/c1-9(17-10(2)21)18-13(22)11-4-6-12(7-5-11)19-14(23)15(3,16)8-20/h4-7,20H,8,16H2,1-3H3,(H,19,23)(H,17,18,21,22) |
| InChIKey | FSDFAZQVCXAHRQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|