C19H17ClN6O2 — CID 137418840
7-benzyl-8-(3-chloropyrazin-2-yl)-3-propan-2-ylpurine-2,6-dione (PubChem CID 137418840) has the molecular formula C19H17ClN6O2 and a molecular weight of 396.84 g/mol. Its IUPAC name is 7-benzyl-8-(3-chloropyrazin-2-yl)-3-propan-2-ylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-(3-chloropyrazin-2-yl)-3-propan-2-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 137418840 |
| Molecular Formula | C19H17ClN6O2 |
| Molecular Weight | 396.84 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 7-benzyl-8-(3-chloropyrazin-2-yl)-3-propan-2-ylpurine-2,6-dione |
| SMILES | CC(C)n1c(=O)[nH]c(=O)c2c1nc(-c1nccnc1Cl)n2Cc1ccccc1 |
| InChI | InChI=1S/C19H17ClN6O2/c1-11(2)26-17-14(18(27)24-19(26)28)25(10-12-6-4-3-5-7-12)16(23-17)13-15(20)22-9-8-21-13/h3-9,11H,10H2,1-2H3,(H,24,27,28) |
| InChIKey | JQGVGWUFAJBGSN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |