C20H26N12O11P2 — CID 137420719
2-amino-9-[17-(6-aminopurin-9-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-4,7,13,16-tetraoxa-2,11-diaza-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one (PubChem CID 137420719) has the molecular formula C20H26N12O11P2 and a molecular weight of 672.45 g/mol. Its IUPAC name is 2-amino-9-[17-(6-aminopurin-9-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-4,7,13,16-tetraoxa-2,11-diaza-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[17-(6-aminopurin-9-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-4,7,13,16-tetraoxa-2,11-diaza-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137420719 |
| Molecular Formula | C20H26N12O11P2 |
| Molecular Weight | 672.45 g/mol |
| Exact Mass | 672.13 |
| IUPAC Name | 2-amino-9-[17-(6-aminopurin-9-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-4,7,13,16-tetraoxa-2,11-diaza-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C2OC3COP(=O)(O)NC4C(COP(=O)(O)NC3C2O)OC(n2cnc3c(N)ncnc32)C4O)c(=O)[nH]1 |
| InChI | InChI=1S/C20H26N12O11P2/c21-14-10-15(24-3-23-14)31(4-25-10)18-12(33)8-6(42-18)1-40-45(38,39)30-9-7(2-41-44(36,37)29-8)43-19(13(9)34)32-5-26-11-16(32)27-20(22)28-17(11)35/h3-9,12-13,18-19,33-34H,1-2H2,(H2,21,23,24)(H2,29,36,37)(H2,30,38,39)(H3,22,27,28,35) |
| InChIKey | PJUHRFXLHLFLFK-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 335.25 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.45 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|