C24H28N12O7 — CID 174024517
(6R,8R,15R,17R)-17-(2-amino-6-oxo-1H-purin-9-yl)-8-(6-aminopurin-9-yl)-9,18-dihydroxy-7,16-dioxa-2,11-diazatricyclo[13.2.1.06,10]octadecane-3,12-dione (PubChem CID 174024517) has the molecular formula C24H28N12O7 and a molecular weight of 596.57 g/mol. Its IUPAC name is (6R,8R,15R,17R)-17-(2-amino-6-oxo-1H-purin-9-yl)-8-(6-aminopurin-9-yl)-9,18-dihydroxy-7,16-dioxa-2,11-diazatricyclo[13.2.1.06,10]octadecane-3,12-dione.
| Compound Name | (6R,8R,15R,17R)-17-(2-amino-6-oxo-1H-purin-9-yl)-8-(6-aminopurin-9-yl)-9,18-dihydroxy-7,16-dioxa-2,11-diazatricyclo[13.2.1.06,10]octadecane-3,12-dione |
|---|---|
| PubChem CID | 174024517 |
| Molecular Formula | C24H28N12O7 |
| Molecular Weight | 596.57 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | (6R,8R,15R,17R)-17-(2-amino-6-oxo-1H-purin-9-yl)-8-(6-aminopurin-9-yl)-9,18-dihydroxy-7,16-dioxa-2,11-diazatricyclo[13.2.1.06,10]octadecane-3,12-dione |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@@H]3CCC(=O)NC4C(O)[C@H](n5cnc6c(N)ncnc65)O[C@@H]4CCC(=O)NC2C3O)c(=O)[nH]1 |
| InChI | InChI=1S/C24H28N12O7/c25-18-14-19(28-5-27-18)35(6-29-14)23-17(40)12-8(42-23)1-3-11(38)32-13-16(39)9(2-4-10(37)31-12)43-22(13)36-7-30-15-20(36)33-24(26)34-21(15)41/h5-9,12-13,16-17,22-23,39-40H,1-4H2,(H,31,37)(H,32,38)(H2,25,27,28)(H3,26,33,34,41)/t8-,9-,12?,13?,16?,17?,22-,23-/m1/s1 |
| InChIKey | VMAHWOQNJRKPAJ-JYKAOJBHSA-N |
| XLogP | -2.82 |
| TPSA | 276.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.57 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |