C23H27N13O8 — CID 159769768
(1R,6R,8R,9S,15R,17R)-8,17-bis(2-amino-6-oxo-1H-purin-9-yl)-9,18-dihydroxy-7,16-dioxa-2,4,11-triazatricyclo[13.3.0.06,10]octadecane-3,12-dione (PubChem CID 159769768) has the molecular formula C23H27N13O8 and a molecular weight of 613.55 g/mol. Its IUPAC name is (1R,6R,8R,9S,15R,17R)-8,17-bis(2-amino-6-oxo-1H-purin-9-yl)-9,18-dihydroxy-7,16-dioxa-2,4,11-triazatricyclo[13.3.0.06,10]octadecane-3,12-dione.
| Compound Name | (1R,6R,8R,9S,15R,17R)-8,17-bis(2-amino-6-oxo-1H-purin-9-yl)-9,18-dihydroxy-7,16-dioxa-2,4,11-triazatricyclo[13.3.0.06,10]octadecane-3,12-dione |
|---|---|
| PubChem CID | 159769768 |
| Molecular Formula | C23H27N13O8 |
| Molecular Weight | 613.55 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | (1R,6R,8R,9S,15R,17R)-8,17-bis(2-amino-6-oxo-1H-purin-9-yl)-9,18-dihydroxy-7,16-dioxa-2,4,11-triazatricyclo[13.3.0.06,10]octadecane-3,12-dione |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@@H]3CCC(=O)NC4[C@@H](CNC(=O)N[C@@H]3C2O)O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H]4O)c(=O)[nH]1 |
| InChI | InChI=1S/C23H27N13O8/c24-21-31-15-11(17(40)33-21)27-4-35(15)19-13(38)9-6(43-19)1-2-8(37)29-10-7(3-26-23(42)30-9)44-20(14(10)39)36-5-28-12-16(36)32-22(25)34-18(12)41/h4-7,9-10,13-14,19-20,38-39H,1-3H2,(H,29,37)(H2,26,30,42)(H3,24,31,33,40)(H3,25,32,34,41)/t6-,7-,9+,10?,13?,14+,19-,20-/m1/s1 |
| InChIKey | ZFZQNKBVPZDVLB-WFSBTPKHSA-N |
| XLogP | -4.12 |
| TPSA | 308.33 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.55 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |