C22H26N14O5S — CID 153278387
(1S,6R,8R,9R,10S,15R,17R,18R)-8,17-bis(6-aminopurin-9-yl)-9,18-dihydroxy-12-sulfanylidene-7,16-dioxa-2,4,11,13-tetrazatricyclo[13.3.0.06,10]octadecan-3-one (PubChem CID 153278387) has the molecular formula C22H26N14O5S and a molecular weight of 598.61 g/mol. Its IUPAC name is (1S,6R,8R,9R,10S,15R,17R,18R)-8,17-bis(6-aminopurin-9-yl)-9,18-dihydroxy-12-sulfanylidene-7,16-dioxa-2,4,11,13-tetrazatricyclo[13.3.0.06,10]octadecan-3-one.
| Compound Name | (1S,6R,8R,9R,10S,15R,17R,18R)-8,17-bis(6-aminopurin-9-yl)-9,18-dihydroxy-12-sulfanylidene-7,16-dioxa-2,4,11,13-tetrazatricyclo[13.3.0.06,10]octadecan-3-one |
|---|---|
| PubChem CID | 153278387 |
| Molecular Formula | C22H26N14O5S |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | (1S,6R,8R,9R,10S,15R,17R,18R)-8,17-bis(6-aminopurin-9-yl)-9,18-dihydroxy-12-sulfanylidene-7,16-dioxa-2,4,11,13-tetrazatricyclo[13.3.0.06,10]octadecan-3-one |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2CNC(=S)N[C@H]3[C@@H](O)[C@H](n4cnc5c(N)ncnc54)O[C@@H]3CNC(=O)N[C@H]2[C@H]1O |
| InChI | InChI=1S/C22H26N14O5S/c23-15-11-17(29-3-27-15)35(5-31-11)19-13(37)9-8(41-19)2-26-22(42)34-10-7(1-25-21(39)33-9)40-20(14(10)38)36-6-32-12-16(24)28-4-30-18(12)36/h3-10,13-14,19-20,37-38H,1-2H2,(H2,23,27,29)(H2,24,28,30)(H2,25,33,39)(H2,26,34,42)/t7-,8-,9-,10-,13-,14-,19-,20-/m1/s1 |
| InChIKey | JSPTVQBDHKPTAA-QPMBAPTHSA-N |
| XLogP | -3.14 |
| TPSA | 263.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|