C23H27N13O7 — CID 148649782
(1S,6R,8R,9S,15R,17R)-17-(2-amino-6-oxo-1H-purin-9-yl)-8-(6-aminopurin-9-yl)-9,18-dihydroxy-7,16-dioxa-2,4,11-triazatricyclo[13.2.1.06,10]octadecane-3,12-dione (PubChem CID 148649782) has the molecular formula C23H27N13O7 and a molecular weight of 597.55 g/mol. Its IUPAC name is (1S,6R,8R,9S,15R,17R)-17-(2-amino-6-oxo-1H-purin-9-yl)-8-(6-aminopurin-9-yl)-9,18-dihydroxy-7,16-dioxa-2,4,11-triazatricyclo[13.2.1.06,10]octadecane-3,12-dione.
| Compound Name | (1S,6R,8R,9S,15R,17R)-17-(2-amino-6-oxo-1H-purin-9-yl)-8-(6-aminopurin-9-yl)-9,18-dihydroxy-7,16-dioxa-2,4,11-triazatricyclo[13.2.1.06,10]octadecane-3,12-dione |
|---|---|
| PubChem CID | 148649782 |
| Molecular Formula | C23H27N13O7 |
| Molecular Weight | 597.55 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | (1S,6R,8R,9S,15R,17R)-17-(2-amino-6-oxo-1H-purin-9-yl)-8-(6-aminopurin-9-yl)-9,18-dihydroxy-7,16-dioxa-2,4,11-triazatricyclo[13.2.1.06,10]octadecane-3,12-dione |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@@H]3CCC(=O)NC4[C@@H](CNC(=O)N[C@H]2C3O)O[C@@H](n2cnc3c(N)ncnc32)[C@H]4O)c(=O)[nH]1 |
| InChI | InChI=1S/C23H27N13O7/c24-16-12-17(28-4-27-16)35(5-29-12)21-15(39)10-8(43-21)3-26-23(41)32-11-14(38)7(1-2-9(37)31-10)42-20(11)36-6-30-13-18(36)33-22(25)34-19(13)40/h4-8,10-11,14-15,20-21,38-39H,1-3H2,(H,31,37)(H2,24,27,28)(H2,26,32,41)(H3,25,33,34,40)/t7-,8-,10?,11+,14?,15+,20-,21-/m1/s1 |
| InChIKey | NLRUKFPXHHTZFV-RSOGDQKISA-N |
| XLogP | -3.41 |
| TPSA | 288.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.55 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |