C17H22FN — CID 137421345
3-tert-butyl-1-cyclopentyl-5-fluoroindole (PubChem CID 137421345) has the molecular formula C17H22FN and a molecular weight of 259.37 g/mol. Its IUPAC name is 3-tert-butyl-1-cyclopentyl-5-fluoroindole.
| Compound Name | 3-tert-butyl-1-cyclopentyl-5-fluoroindole |
|---|---|
| PubChem CID | 137421345 |
| Molecular Formula | C17H22FN |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-tert-butyl-1-cyclopentyl-5-fluoroindole |
| SMILES | CC(C)(C)c1cn(C2CCCC2)c2ccc(F)cc12 |
| InChI | InChI=1S/C17H22FN/c1-17(2,3)15-11-19(13-6-4-5-7-13)16-9-8-12(18)10-14(15)16/h8-11,13H,4-7H2,1-3H3 |
| InChIKey | RLOUATNMVAHVGU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |