C28H30FN7O2 — CID 137421458
N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[6-(5-fluoro-1-methylindol-3-yl)pyrimidin-4-yl]amino]-4-formylphenyl]prop-2-enamide (PubChem CID 137421458) has the molecular formula C28H30FN7O2 and a molecular weight of 515.59 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[6-(5-fluoro-1-methylindol-3-yl)pyrimidin-4-yl]amino]-4-formylphenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[6-(5-fluoro-1-methylindol-3-yl)pyrimidin-4-yl]amino]-4-formylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 137421458 |
| Molecular Formula | C28H30FN7O2 |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[6-(5-fluoro-1-methylindol-3-yl)pyrimidin-4-yl]amino]-4-formylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2cc(-c3cn(C)c4ccc(F)cc34)ncn2)c(C=O)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C28H30FN7O2/c1-6-28(38)33-24-13-22(18(16-37)11-26(24)35(4)10-9-34(2)3)32-27-14-23(30-17-31-27)21-15-36(5)25-8-7-19(29)12-20(21)25/h6-8,11-17H,1,9-10H2,2-5H3,(H,33,38)(H,30,31,32) |
| InChIKey | INUXFAQQRLMUJN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|