C30H37N7O — CID 135369120
N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[6-(1-methylindol-3-yl)pyrimidin-4-yl]amino]-4-propylphenyl]prop-2-enamide (PubChem CID 135369120) has the molecular formula C30H37N7O and a molecular weight of 511.67 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[6-(1-methylindol-3-yl)pyrimidin-4-yl]amino]-4-propylphenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[6-(1-methylindol-3-yl)pyrimidin-4-yl]amino]-4-propylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135369120 |
| Molecular Formula | C30H37N7O |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[6-(1-methylindol-3-yl)pyrimidin-4-yl]amino]-4-propylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2cc(-c3cn(C)c4ccccc34)ncn2)c(CCC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C30H37N7O/c1-7-11-21-16-28(36(5)15-14-35(3)4)26(34-30(38)8-2)17-24(21)33-29-18-25(31-20-32-29)23-19-37(6)27-13-10-9-12-22(23)27/h8-10,12-13,16-20H,2,7,11,14-15H2,1,3-6H3,(H,34,38)(H,31,32,33) |
| InChIKey | XZDMHHCFNAQJKM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|