C27H31N7O2 — CID 176878260
N-[2-[2-(dimethylamino)ethyl-methylamino]-4-hydroxy-5-[[6-(1-methylindol-3-yl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 176878260) has the molecular formula C27H31N7O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-4-hydroxy-5-[[6-(1-methylindol-3-yl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-hydroxy-5-[[6-(1-methylindol-3-yl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 176878260 |
| Molecular Formula | C27H31N7O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-hydroxy-5-[[6-(1-methylindol-3-yl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2cc(-c3cn(C)c4ccccc34)ncn2)c(O)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C27H31N7O2/c1-6-27(36)31-21-13-22(25(35)15-24(21)33(4)12-11-32(2)3)30-26-14-20(28-17-29-26)19-16-34(5)23-10-8-7-9-18(19)23/h6-10,13-17,35H,1,11-12H2,2-5H3,(H,31,36)(H,28,29,30) |
| InChIKey | TZNGXOAAUUZDAE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|