C29H33N7O2 — CID 137421766
N-[4-methoxy-2-(4-methyl-1,4-diazepan-1-yl)-5-[[6-(1-methylindol-3-yl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 137421766) has the molecular formula C29H33N7O2 and a molecular weight of 511.63 g/mol. Its IUPAC name is N-[4-methoxy-2-(4-methyl-1,4-diazepan-1-yl)-5-[[6-(1-methylindol-3-yl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[4-methoxy-2-(4-methyl-1,4-diazepan-1-yl)-5-[[6-(1-methylindol-3-yl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 137421766 |
| Molecular Formula | C29H33N7O2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | N-[4-methoxy-2-(4-methyl-1,4-diazepan-1-yl)-5-[[6-(1-methylindol-3-yl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2cc(-c3cn(C)c4ccccc34)ncn2)c(OC)cc1N1CCCN(C)CC1 |
| InChI | InChI=1S/C29H33N7O2/c1-5-29(37)33-23-15-24(27(38-4)17-26(23)36-12-8-11-34(2)13-14-36)32-28-16-22(30-19-31-28)21-18-35(3)25-10-7-6-9-20(21)25/h5-7,9-10,15-19H,1,8,11-14H2,2-4H3,(H,33,37)(H,30,31,32) |
| InChIKey | JCSPRENKOATBLS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|