C13H8S2 — CID 137421775
11,15-dithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene (PubChem CID 137421775) has the molecular formula C13H8S2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 11,15-dithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene.
| Compound Name | 11,15-dithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene |
|---|---|
| PubChem CID | 137421775 |
| Molecular Formula | C13H8S2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 11,15-dithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene |
| SMILES | c1ccc2c(c1)Cc1c-2sc2ccsc12 |
| InChI | InChI=1S/C13H8S2/c1-2-4-9-8(3-1)7-10-12(9)15-11-5-6-14-13(10)11/h1-6H,7H2 |
| InChIKey | IQBHENYSEUHGCD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |